Products 1016761-70-8
CAS 1016761-70-8 is the registry number for 5-Cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS 1016761-70-8) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylic acid. InChIKey: CGMNZWYGTFJKTF-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | CGMNZWYGTFJKTF-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(N=C(O2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)