Products 1016770-92-5
CAS 1016770-92-5 appears in our catalog under these names: 1-Chloro-3-(3-fluorophenyl)propan-2-one, 95%, 1-Chloro-3-(3-fluorophenyl)propan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-chloro-3-(3-fluorophenyl)propan-2-one (CAS 1016770-92-5) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-chloro-3-(3-fluorophenyl)propan-2-one. InChIKey: VUFXQHYUTJYLLO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-chloro-3-(3-fluorophenyl)propan-2-one |
| InChIKey | VUFXQHYUTJYLLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC(=O)CCl |
Computed by PubChem (NCBI)