CAS 1017059-26-5 appears in our catalog under these names: (3,5-Difluoro-4-hydroxyphenyl)acetone, 95%, (3,5-Difluoro-4-hydroxyphenyl)acetone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
1-(3,5-difluoro-4-hydroxyphenyl)propan-2-one (CAS 1017059-26-5) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 1-(3,5-difluoro-4-hydroxyphenyl)propan-2-one. InChIKey: QAHZIEKZQOFJPK-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 1-(3,5-difluoro-4-hydroxyphenyl)propan-2-one |
| InChIKey | QAHZIEKZQOFJPK-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=C(C(=C1)F)O)F |
Computed by PubChem (NCBI)