CAS 1017294-05-1 is the registry number for (R)-Methyl 2-acetamido-3-(2,5-difluorophenyl)propanoate, 97%. Offered by: AmBeed. Available pack sizes: 25g.
Methyl (2R)-2-acetamido-3-(2,5-difluorophenyl)propanoate (CAS 1017294-05-1) is a chemical compound with the molecular formula C12H13F2NO3 and a molecular weight of 257.23 g/mol. IUPAC name: methyl (2R)-2-acetamido-3-(2,5-difluorophenyl)propanoate. InChIKey: MUYYHZGDYKCCAY-LLVKDONJSA-N.
| Molecular formula | C12H13F2NO3 |
|---|---|
| Molecular weight | 257.23 g/mol |
| IUPAC name | methyl (2R)-2-acetamido-3-(2,5-difluorophenyl)propanoate |
| InChIKey | MUYYHZGDYKCCAY-LLVKDONJSA-N |
| SMILES | CC(=O)N[C@H](CC1=C(C=CC(=C1)F)F)C(=O)OC |
Computed by PubChem (NCBI)