Products 1025059-05-5
CAS 1025059-05-5 is the registry number for 2-(3,4-Difluorophenyl)-2-(N-ethylacetamido)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[acetyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid (CAS 1025059-05-5) is a chemical compound with the molecular formula C12H13F2NO3 and a molecular weight of 257.23 g/mol. IUPAC name: 2-[acetyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid. InChIKey: BNAVPWVXJNYXRJ-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO3 |
|---|---|
| Molecular weight | 257.23 g/mol |
| IUPAC name | 2-[acetyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid |
| InChIKey | BNAVPWVXJNYXRJ-UHFFFAOYSA-N |
| SMILES | CCN(C(C1=CC(=C(C=C1)F)F)C(=O)O)C(=O)C |
Computed by PubChem (NCBI)