Products 1436389-44-4
CAS 1436389-44-4 is the registry number for Ethyl (4-(acetylamino)phenyl)(difluoro)acetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
Ethyl 2-(4-acetamidophenyl)-2,2-difluoroacetate (CAS 1436389-44-4) is a chemical compound with the molecular formula C12H13F2NO3 and a molecular weight of 257.23 g/mol. IUPAC name: ethyl 2-(4-acetamidophenyl)-2,2-difluoroacetate. InChIKey: RRECPSVDKRPSBX-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO3 |
|---|---|
| Molecular weight | 257.23 g/mol |
| IUPAC name | ethyl 2-(4-acetamidophenyl)-2,2-difluoroacetate |
| InChIKey | RRECPSVDKRPSBX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=C(C=C1)NC(=O)C)(F)F |
Computed by PubChem (NCBI)