CAS 1485705-79-0 appears in our catalog under these names: 3-((3,5-Difluorophenyl)carbamoyl)-2,2-dimethylpropanoic acid, 95%, 3-((3,5-Difluorophenyl)carbamoyl)-2,2-dimethylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(3,5-difluoroanilino)-2,2-dimethyl-4-oxobutanoic acid (CAS 1485705-79-0) is a chemical compound with the molecular formula C12H13F2NO3 and a molecular weight of 257.23 g/mol. IUPAC name: 4-(3,5-difluoroanilino)-2,2-dimethyl-4-oxobutanoic acid. InChIKey: IMPRUZOWKXAIGO-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO3 |
|---|---|
| Molecular weight | 257.23 g/mol |
| IUPAC name | 4-(3,5-difluoroanilino)-2,2-dimethyl-4-oxobutanoic acid |
| InChIKey | IMPRUZOWKXAIGO-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)NC1=CC(=CC(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)