Products 131401-56-4
CAS 131401-56-4 appears in our catalog under these names: N,N–Diethyl–3,6–difluorophthalamic acid, N,N-Diethyl-3,6-difluorophthalamic acid, 98%, 98%, 2-(Diethylcarbamoyl)-3,6-difluorobenzoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg.
2-(diethylcarbamoyl)-3,6-difluorobenzoic acid (CAS 131401-56-4) is a chemical compound with the molecular formula C12H13F2NO3 and a molecular weight of 257.23 g/mol. IUPAC name: 2-(diethylcarbamoyl)-3,6-difluorobenzoic acid. InChIKey: DYPGXWRGWRATMM-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO3 |
|---|---|
| Molecular weight | 257.23 g/mol |
| IUPAC name | 2-(diethylcarbamoyl)-3,6-difluorobenzoic acid |
| InChIKey | DYPGXWRGWRATMM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=CC(=C1C(=O)O)F)F |
Computed by PubChem (NCBI)