Products 1396972-19-2
CAS 1396972-19-2 appears in our catalog under these names: 2-((2,6-Difluorophenyl)formamido)-3-methylbutanoic acid, 2-[(2,6-Difluorophenyl)formamido]-3-methylbutanoic acid, 95%, 2-((2,6-Difluorophenyl)formamido)-3-methylbutanoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoic acid (CAS 1396972-19-2) is a chemical compound with the molecular formula C12H13F2NO3 and a molecular weight of 257.23 g/mol. IUPAC name: 2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoic acid. InChIKey: RNOQHFYNGRGYKE-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO3 |
|---|---|
| Molecular weight | 257.23 g/mol |
| IUPAC name | 2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoic acid |
| InChIKey | RNOQHFYNGRGYKE-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NC(=O)C1=C(C=CC=C1F)F |
Computed by PubChem (NCBI)