CAS 874784-13-1 is the registry number for 6-[(2,2-Dimethylpropanoyl)amino]-2,3-difluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-(2,2-dimethylpropanoylamino)-2,3-difluorobenzoic acid (CAS 874784-13-1) is a chemical compound with the molecular formula C12H13F2NO3 and a molecular weight of 257.23 g/mol. IUPAC name: 6-(2,2-dimethylpropanoylamino)-2,3-difluorobenzoic acid. InChIKey: KNCVGCGLFIHUST-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO3 |
|---|---|
| Molecular weight | 257.23 g/mol |
| IUPAC name | 6-(2,2-dimethylpropanoylamino)-2,3-difluorobenzoic acid |
| InChIKey | KNCVGCGLFIHUST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C(=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)