Products 874784-13-1

CAS 874784-13-1 is the registry number for 6-[(2,2-Dimethylpropanoyl)amino]-2,3-difluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

6-(2,2-dimethylpropanoylamino)-2,3-difluorobenzoic acid (CAS 874784-13-1) is a chemical compound with the molecular formula C12H13F2NO3 and a molecular weight of 257.23 g/mol. IUPAC name: 6-(2,2-dimethylpropanoylamino)-2,3-difluorobenzoic acid. InChIKey: KNCVGCGLFIHUST-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13F2NO3
Molecular weight257.23 g/mol
IUPAC name6-(2,2-dimethylpropanoylamino)-2,3-difluorobenzoic acid
InChIKeyKNCVGCGLFIHUST-UHFFFAOYSA-N
SMILESCC(C)(C)C(=O)NC1=C(C(=C(C=C1)F)F)C(=O)O

Computed by PubChem (NCBI)