CAS 10173-52-1 is the registry number for 2-(5-Chloro-1H-1,3-benzodiazol-2-yl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(6-chloro-1H-benzimidazol-2-yl)aniline (CAS 10173-52-1) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 2-(6-chloro-1H-benzimidazol-2-yl)aniline. InChIKey: CWVOGEATHKXBNE-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 2-(6-chloro-1H-benzimidazol-2-yl)aniline |
| InChIKey | CWVOGEATHKXBNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(N2)C=C(C=C3)Cl)N |
Computed by PubChem (NCBI)