CAS 54001-15-9 appears in our catalog under these names: 4-Methyl-2-(2-methylphenyl)-1,3-thiazole-5-carboxylic acid, 95%, 4-Methyl-2-(o-tolyl)thiazole-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
4-methyl-2-(2-methylphenyl)-1,3-thiazole-5-carboxylic acid (CAS 54001-15-9) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: 4-methyl-2-(2-methylphenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: OFTVPKQWPZKNMB-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 4-methyl-2-(2-methylphenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | OFTVPKQWPZKNMB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NC(=C(S2)C(=O)O)C |
Computed by PubChem (NCBI)