Products 1017402-13-9
CAS 1017402-13-9 appears in our catalog under these names: 1-(3-Chlorophenyl)-5-propyl-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(3-Chlorophenyl)-5-propyl-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 100mg.
1-(3-chlorophenyl)-5-propyltriazole-4-carboxylic acid (CAS 1017402-13-9) is a chemical compound with the molecular formula C12H12ClN3O2 and a molecular weight of 265.69 g/mol. IUPAC name: 1-(3-chlorophenyl)-5-propyltriazole-4-carboxylic acid. InChIKey: KRDXQAHRVXCDRX-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-5-propyltriazole-4-carboxylic acid |
| InChIKey | KRDXQAHRVXCDRX-UHFFFAOYSA-N |
| SMILES | CCCC1=C(N=NN1C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)