CAS 1017414-83-3 appears in our catalog under these names: 5–(4–Chlorophenyl)–1–methyl–1H–pyrrole–2–carboxylic acid, 5-(4-Chlorophenyl)-1-methyl-1H-pyrrole-2-carboxylic acid, 95%, 95%, 5-(4-Chlorophenyl)-1-methyl-1H-pyrrole-2-carboxylic acid, 98%, 5-(4-Chlorophenyl)-1-methyl-1H-pyrrole-2-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
5-(4-chlorophenyl)-1-methylpyrrole-2-carboxylic acid (CAS 1017414-83-3) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: 5-(4-chlorophenyl)-1-methylpyrrole-2-carboxylic acid. InChIKey: SGAKOFWKZBYYON-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1-methylpyrrole-2-carboxylic acid |
| InChIKey | SGAKOFWKZBYYON-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=C1C(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)