CAS 10177-08-9 appears in our catalog under these names: 2-Oxo-5-phenyl-1,2-dihydropyridine-3-carboxylic acid, 96%, 2-Hydroxy-5-phenylnicotinic acid, 96%, 2–Oxo–5–phenyl–1,2–dihydropyridine–3–carboxylic acid, 2-Oxo-5-phenyl-1,2-dihydropyridine-3-carboxylic acid 95%, 2-Hydroxy-5-phenylnicotinic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
2-oxo-5-phenyl-1H-pyridine-3-carboxylic acid (CAS 10177-08-9) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 2-oxo-5-phenyl-1H-pyridine-3-carboxylic acid. InChIKey: SIHMMTANWQXEHE-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-oxo-5-phenyl-1H-pyridine-3-carboxylic acid |
| InChIKey | SIHMMTANWQXEHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CNC(=O)C(=C2)C(=O)O |
Computed by PubChem (NCBI)