CAS 1018142-01-2 is the registry number for 5-Chloro-6-cyclopropyl-1,3-dimethyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-chloro-6-cyclopropyl-1,3-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid (CAS 1018142-01-2) is a chemical compound with the molecular formula C12H12ClN3O2 and a molecular weight of 265.69 g/mol. IUPAC name: 5-chloro-6-cyclopropyl-1,3-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid. InChIKey: DZRURMZYAMDNAK-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | 5-chloro-6-cyclopropyl-1,3-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid |
| InChIKey | DZRURMZYAMDNAK-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=NC(=C(C(=C12)C(=O)O)Cl)C3CC3)C |
Computed by PubChem (NCBI)