Products 1018520-20-1
CAS 1018520-20-1 appears in our catalog under these names: (2,3-Dihydro-1,4-benzodioxin-2-yl)methanesulfonyl chloride, 95%, (2,3-Dihydro-1,4-benzodioxin-2-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2,3-dihydro-1,4-benzodioxin-3-ylmethanesulfonyl chloride (CAS 1018520-20-1) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-3-ylmethanesulfonyl chloride. InChIKey: FPDPLSQAWVJKJD-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-3-ylmethanesulfonyl chloride |
| InChIKey | FPDPLSQAWVJKJD-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)