Products 1018531-56-0
CAS 1018531-56-0 is the registry number for 3-Amino-N-(3-chloro-4-methylphenyl)benzenepropanamide, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg.
3-(3-aminophenyl)-N-(3-chloro-4-methylphenyl)propanamide (CAS 1018531-56-0) is a chemical compound with the molecular formula C16H17ClN2O and a molecular weight of 288.77 g/mol. IUPAC name: 3-(3-aminophenyl)-N-(3-chloro-4-methylphenyl)propanamide. InChIKey: AXZHJHZWPMHWOG-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O |
|---|---|
| Molecular weight | 288.77 g/mol |
| IUPAC name | 3-(3-aminophenyl)-N-(3-chloro-4-methylphenyl)propanamide |
| InChIKey | AXZHJHZWPMHWOG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)CCC2=CC(=CC=C2)N)Cl |
Computed by PubChem (NCBI)