Products 1018603-62-7
CAS 1018603-62-7 is the registry number for N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-n-(ethylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[2,3-dihydro-1,4-benzodioxin-6-yl(ethylsulfonyl)amino]acetic acid (CAS 1018603-62-7) is a chemical compound with the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. IUPAC name: 2-[2,3-dihydro-1,4-benzodioxin-6-yl(ethylsulfonyl)amino]acetic acid. InChIKey: SZSFRMRAZQCBKP-UHFFFAOYSA-N.
| Molecular formula | C12H15NO6S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | 2-[2,3-dihydro-1,4-benzodioxin-6-yl(ethylsulfonyl)amino]acetic acid |
| InChIKey | SZSFRMRAZQCBKP-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N(CC(=O)O)C1=CC2=C(C=C1)OCCO2 |
Computed by PubChem (NCBI)