CAS 775314-99-3 appears in our catalog under these names: 3-[(3,4-Dihydro-2h-1,5-benzodioxepin-7-ylsulfonyl)amino]propanoic acid, 95%, 3-(3,4-Dihydro-2H-1,5-benzodioxepine-7-sulfonamido)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)propanoic acid (CAS 775314-99-3) is a chemical compound with the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. IUPAC name: 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)propanoic acid. InChIKey: MLOYLSJFWZFPEV-UHFFFAOYSA-N.
| Molecular formula | C12H15NO6S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)propanoic acid |
| InChIKey | MLOYLSJFWZFPEV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)S(=O)(=O)NCCC(=O)O)OC1 |
Computed by PubChem (NCBI)