Products 1373232-81-5
CAS 1373232-81-5 is the registry number for 1,3-Dimethyl 2-(2-amino-4-methanesulfonylphenyl)propanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Dimethyl 2-(2-amino-4-methylsulfonylphenyl)propanedioate (CAS 1373232-81-5) is a chemical compound with the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. IUPAC name: dimethyl 2-(2-amino-4-methylsulfonylphenyl)propanedioate. InChIKey: ZKBQKTBLEZFORV-UHFFFAOYSA-N.
| Molecular formula | C12H15NO6S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | dimethyl 2-(2-amino-4-methylsulfonylphenyl)propanedioate |
| InChIKey | ZKBQKTBLEZFORV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=C1)S(=O)(=O)C)N)C(=O)OC |
Computed by PubChem (NCBI)