CAS 4816-80-2 appears in our catalog under these names: (S)-2-(4-Methylphenylsulfonamido)pentanedioic acid, 95%, (S)-2-(4-Methylphenylsulfonamido)pentanedioic acid, 97%, (S)-2-(4-Methylphenylsulfonamido)pentanedioic acid, 97%, 97%, N-(P-Tolylsulphonyl)-l-glutamic acid, 97%, N-Tosyl-L-glutamic Acid. Offered by: AmBeed, Fluorochem, Chemat, Combi-blocks, TRC. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 50g, 250g.
(2S)-2-[(4-methylphenyl)sulfonylamino]pentanedioic acid (CAS 4816-80-2) is a chemical compound with the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. IUPAC name: (2S)-2-[(4-methylphenyl)sulfonylamino]pentanedioic acid. InChIKey: KKOZKXBAPIYWAT-JTQLQIEISA-N.
| Molecular formula | C12H15NO6S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | (2S)-2-[(4-methylphenyl)sulfonylamino]pentanedioic acid |
| InChIKey | KKOZKXBAPIYWAT-JTQLQIEISA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)