CAS 168890-59-3 appears in our catalog under these names: 2-Methoxy-5-(morpholine-4-sulfonyl)-benzoic acid, 95%, 2-Methoxy-5-(morpholinosulfonyl)benzoic acid, 95%, 95%, 2-Methoxy-5-(morpholine-4-sulfonyl)-benzoic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-methoxy-5-morpholin-4-ylsulfonylbenzoic acid (CAS 168890-59-3) is a chemical compound with the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. IUPAC name: 2-methoxy-5-morpholin-4-ylsulfonylbenzoic acid. InChIKey: IJQQDWZRROHWPL-UHFFFAOYSA-N.
| Molecular formula | C12H15NO6S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | 2-methoxy-5-morpholin-4-ylsulfonylbenzoic acid |
| InChIKey | IJQQDWZRROHWPL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N2CCOCC2)C(=O)O |
Computed by PubChem (NCBI)