Products 1858254-97-3
CAS 1858254-97-3 is the registry number for 4-[1,3-Benzodioxol-5-yl(methylsulfonyl)amino]butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]butanoic acid (CAS 1858254-97-3) is a chemical compound with the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. IUPAC name: 4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]butanoic acid. InChIKey: UXCMWBDHDMBUNV-UHFFFAOYSA-N.
| Molecular formula | C12H15NO6S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | 4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]butanoic acid |
| InChIKey | UXCMWBDHDMBUNV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N(CCCC(=O)O)C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)