CAS 300571-94-2 appears in our catalog under these names: 4-[(2,3-Dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]butanoic acid, 95%, 4-(2,3-dihydrobenzo(b)(1,4)dioxine-6-sulfonamido)butanoic acid, 95+%, 4-(2,3-Dihydro-benzo(1,4)dioxine-6-sulfonylamino)-butyric acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 2,5g.
4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoic acid (CAS 300571-94-2) is a chemical compound with the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. IUPAC name: 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoic acid. InChIKey: DGXXDRKDKYCRLS-UHFFFAOYSA-N.
| Molecular formula | C12H15NO6S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoic acid |
| InChIKey | DGXXDRKDKYCRLS-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)NCCCC(=O)O |
Computed by PubChem (NCBI)