Products 10187-21-0
CAS 10187-21-0 is the registry number for 1-(4-Hydroxyphenyl)pyrrolidine-2,5-dione. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(4-hydroxyphenyl)pyrrolidine-2,5-dione (CAS 10187-21-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 1-(4-hydroxyphenyl)pyrrolidine-2,5-dione. InChIKey: SWLPIQAFVWFMIR-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)pyrrolidine-2,5-dione |
| InChIKey | SWLPIQAFVWFMIR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)