Products 1019009-03-0

CAS 1019009-03-0 is the registry number for 5-Amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-amino-1-(2,4-dichlorophenyl)pyrazole-4-carboxylic acid (CAS 1019009-03-0) is a chemical compound with the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.08 g/mol. IUPAC name: 5-amino-1-(2,4-dichlorophenyl)pyrazole-4-carboxylic acid. InChIKey: WCLJWSMKOJRMJN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7Cl2N3O2
Molecular weight272.08 g/mol
IUPAC name5-amino-1-(2,4-dichlorophenyl)pyrazole-4-carboxylic acid
InChIKeyWCLJWSMKOJRMJN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)Cl)N2C(=C(C=N2)C(=O)O)N

Computed by PubChem (NCBI)