CAS 1019009-03-0 is the registry number for 5-Amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-1-(2,4-dichlorophenyl)pyrazole-4-carboxylic acid (CAS 1019009-03-0) is a chemical compound with the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.08 g/mol. IUPAC name: 5-amino-1-(2,4-dichlorophenyl)pyrazole-4-carboxylic acid. InChIKey: WCLJWSMKOJRMJN-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O2 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 5-amino-1-(2,4-dichlorophenyl)pyrazole-4-carboxylic acid |
| InChIKey | WCLJWSMKOJRMJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)N2C(=C(C=N2)C(=O)O)N |
Computed by PubChem (NCBI)