Products 2415220-82-3
CAS 2415220-82-3 is the registry number for Methyl 5-chloro-2-(4-chloro-1H-1,2,3-triazol-1-yl)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 5-chloro-2-(4-chlorotriazol-1-yl)benzoate (CAS 2415220-82-3) is a chemical compound with the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.08 g/mol. IUPAC name: methyl 5-chloro-2-(4-chlorotriazol-1-yl)benzoate. InChIKey: GQVHIEOJCMVCTH-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O2 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | methyl 5-chloro-2-(4-chlorotriazol-1-yl)benzoate |
| InChIKey | GQVHIEOJCMVCTH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)N2C=C(N=N2)Cl |
Computed by PubChem (NCBI)