CAS 333444-52-3 appears in our catalog under these names: 1-(3,4-Dichlorobenzyl)-4-nitro-1h-pyrazole, 95%, 1–(3,4–Dichlorobenzyl)–4–nitro–1H–pyrazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-[(3,4-dichlorophenyl)methyl]-4-nitropyrazole (CAS 333444-52-3) is a chemical compound with the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.08 g/mol. IUPAC name: 1-[(3,4-dichlorophenyl)methyl]-4-nitropyrazole. InChIKey: PRYDAKMUWSCXRC-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O2 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 1-[(3,4-dichlorophenyl)methyl]-4-nitropyrazole |
| InChIKey | PRYDAKMUWSCXRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN2C=C(C=N2)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)