Products 1219393-12-0
CAS 1219393-12-0 appears in our catalog under these names: 3-Hydroxy Anagrelide-13C3, 3-Hydroxy Anagrelide-13C3 (~80%). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 0,5mg, 2,5mg, 5mg.
6,7-dichloro-3-hydroxy-3,5-dihydro-1H-(2,4,5-13C3)imidazolo[2,1-b]quinazolin-2-one (CAS 1219393-12-0) is a chemical compound with the molecular formula C10H7Cl2N3O2 and a molecular weight of 275.06 g/mol. IUPAC name: 6,7-dichloro-3-hydroxy-3,5-dihydro-1H-(2,4,5-13C3)imidazolo[2,1-b]quinazolin-2-one. InChIKey: KAXTUTDKZVOONF-SKMPNTIBSA-N.
| Molecular formula | C10H7Cl2N3O2 |
|---|---|
| Molecular weight | 275.06 g/mol |
| IUPAC name | 6,7-dichloro-3-hydroxy-3,5-dihydro-1H-(2,4,5-13C3)imidazolo[2,1-b]quinazolin-2-one |
| InChIKey | KAXTUTDKZVOONF-SKMPNTIBSA-N |
| SMILES | C1C2=C(C=CC(=C2Cl)Cl)N=[13C]3N1[13CH]([13C](=O)N3)O |
Computed by PubChem (NCBI)