CAS 103058-79-3 is the registry number for 1-(2,4-Dichlorophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,4-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid (CAS 103058-79-3) is a chemical compound with the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.08 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid. InChIKey: BVKZMZBRCLNUBT-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O2 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | BVKZMZBRCLNUBT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1C2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)