Products 1999825-20-5

CAS 1999825-20-5 is the registry number for 1-(2,3-Dichlorobenzyl)-1h-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-[(2,3-dichlorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid (CAS 1999825-20-5) is a chemical compound with the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.08 g/mol. IUPAC name: 1-[(2,3-dichlorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid. InChIKey: GDJRPMAPIDZCSV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7Cl2N3O2
Molecular weight272.08 g/mol
IUPAC name1-[(2,3-dichlorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid
InChIKeyGDJRPMAPIDZCSV-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)Cl)CN2C=NC(=N2)C(=O)O

Computed by PubChem (NCBI)