CAS 1253906-28-3 appears in our catalog under these names: 1-((2,4-Dichlorophenyl)methyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 1-((2,4-Dichlorophenyl)methyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-[(2,4-dichlorophenyl)methyl]triazole-4-carboxylic acid (CAS 1253906-28-3) is a chemical compound with the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.08 g/mol. IUPAC name: 1-[(2,4-dichlorophenyl)methyl]triazole-4-carboxylic acid. InChIKey: BOJOBFVDYCGLCW-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O2 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 1-[(2,4-dichlorophenyl)methyl]triazole-4-carboxylic acid |
| InChIKey | BOJOBFVDYCGLCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CN2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)