Products 1019016-07-9
CAS 1019016-07-9 appears in our catalog under these names: 6-Bromo-8-fluoro-4-hydroxyquinoline-3-carboxylic acid, 98%, 6-Bromo-8-fluoro-4-hydroxyquinoline-3-carboxylic acid, 6-Bromo-8-fluoro-4-hydroxyquinoline-3-carboxylic acid, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
6-bromo-8-fluoro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 1019016-07-9) is a chemical compound with the molecular formula C10H5BrFNO3 and a molecular weight of 286.05 g/mol. IUPAC name: 6-bromo-8-fluoro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: JQJQQEWGNXPSQV-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO3 |
|---|---|
| Molecular weight | 286.05 g/mol |
| IUPAC name | 6-bromo-8-fluoro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | JQJQQEWGNXPSQV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=CN2)C(=O)O)F)Br |
Computed by PubChem (NCBI)