Products 1890113-35-5

CAS 1890113-35-5 is the registry number for 3-Bromo-6-fluoro-2-oxo-1,2-dihydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-bromo-6-fluoro-2-oxo-1H-quinoline-4-carboxylic acid (CAS 1890113-35-5) is a chemical compound with the molecular formula C10H5BrFNO3 and a molecular weight of 286.05 g/mol. IUPAC name: 3-bromo-6-fluoro-2-oxo-1H-quinoline-4-carboxylic acid. InChIKey: CLERMFQUJIZSGV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5BrFNO3
Molecular weight286.05 g/mol
IUPAC name3-bromo-6-fluoro-2-oxo-1H-quinoline-4-carboxylic acid
InChIKeyCLERMFQUJIZSGV-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1F)C(=C(C(=O)N2)Br)C(=O)O

Computed by PubChem (NCBI)