CAS 1890113-35-5 is the registry number for 3-Bromo-6-fluoro-2-oxo-1,2-dihydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-6-fluoro-2-oxo-1H-quinoline-4-carboxylic acid (CAS 1890113-35-5) is a chemical compound with the molecular formula C10H5BrFNO3 and a molecular weight of 286.05 g/mol. IUPAC name: 3-bromo-6-fluoro-2-oxo-1H-quinoline-4-carboxylic acid. InChIKey: CLERMFQUJIZSGV-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO3 |
|---|---|
| Molecular weight | 286.05 g/mol |
| IUPAC name | 3-bromo-6-fluoro-2-oxo-1H-quinoline-4-carboxylic acid |
| InChIKey | CLERMFQUJIZSGV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=C(C(=O)N2)Br)C(=O)O |
Computed by PubChem (NCBI)