Products 1339156-37-4
CAS 1339156-37-4 is the registry number for 8-Bromo-6-fluoro-4-oxo-1,4-dihydroquinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
8-bromo-6-fluoro-4-oxo-1H-quinoline-2-carboxylic acid (CAS 1339156-37-4) is a chemical compound with the molecular formula C10H5BrFNO3 and a molecular weight of 286.05 g/mol. IUPAC name: 8-bromo-6-fluoro-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: QDLTZLVGRSIQRV-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO3 |
|---|---|
| Molecular weight | 286.05 g/mol |
| IUPAC name | 8-bromo-6-fluoro-4-oxo-1H-quinoline-2-carboxylic acid |
| InChIKey | QDLTZLVGRSIQRV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C=C(N2)C(=O)O)Br)F |
Computed by PubChem (NCBI)