Products 1245224-36-5
CAS 1245224-36-5 appears in our catalog under these names: 5–(4–Bromo–2–fluorophenyl)isoxazole–3–carboxylic acid, 5-(4-Bromo-2-fluorophenyl)isoxazole-3-carboxylic acid, 97%, 97%, 5-(4-BROMO-2-FLUOROPHENYL)ISOXAZOLE-3-CARBOXYLIC ACID, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg.
5-(4-bromo-2-fluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1245224-36-5) is a chemical compound with the molecular formula C10H5BrFNO3 and a molecular weight of 286.05 g/mol. IUPAC name: 5-(4-bromo-2-fluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: VDOXPPXIXKJWIF-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO3 |
|---|---|
| Molecular weight | 286.05 g/mol |
| IUPAC name | 5-(4-bromo-2-fluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | VDOXPPXIXKJWIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)