Products 1019016-15-9
CAS 1019016-15-9 appears in our catalog under these names: 8-Bromo-6-fluoro-4-hydroxyquinoline-3-carboxylic acid, 97%, 8-Bromo-6-fluoro-4-hydroxyquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
8-bromo-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 1019016-15-9) is a chemical compound with the molecular formula C10H5BrFNO3 and a molecular weight of 286.05 g/mol. IUPAC name: 8-bromo-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: LVUZMPYPFCZPIL-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO3 |
|---|---|
| Molecular weight | 286.05 g/mol |
| IUPAC name | 8-bromo-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | LVUZMPYPFCZPIL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=CN2)C(=O)O)Br)F |
Computed by PubChem (NCBI)