CAS 1065093-62-0 appears in our catalog under these names: 8-Bromo-5-fluoro-4-hydroxy-quinoline-3-carboxylic acid, 95%, 8-Bromo-5-fluoro-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid, 95%, 8-Bromo-5-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
8-bromo-5-fluoro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 1065093-62-0) is a chemical compound with the molecular formula C10H5BrFNO3 and a molecular weight of 286.05 g/mol. IUPAC name: 8-bromo-5-fluoro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: PYLPYUFSELJLEK-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO3 |
|---|---|
| Molecular weight | 286.05 g/mol |
| IUPAC name | 8-bromo-5-fluoro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | PYLPYUFSELJLEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)C(=O)C(=CN2)C(=O)O)Br |
Computed by PubChem (NCBI)