Products 1248449-30-0
CAS 1248449-30-0 is the registry number for 2-(4-Bromo-2-fluorophenyl)-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4-bromo-2-fluorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 1248449-30-0) is a chemical compound with the molecular formula C10H5BrFNO3 and a molecular weight of 286.05 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: CSERUWCULLPIGW-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO3 |
|---|---|
| Molecular weight | 286.05 g/mol |
| IUPAC name | 2-(4-bromo-2-fluorophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | CSERUWCULLPIGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C2=NC(=CO2)C(=O)O |
Computed by PubChem (NCBI)