CAS 1019385-18-2 is the registry number for 5,8-Dichloro-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5,8-dichloro-1,2,3,4-tetrahydroquinoline (CAS 1019385-18-2) is a chemical compound with the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. IUPAC name: 5,8-dichloro-1,2,3,4-tetrahydroquinoline. InChIKey: RPFUXGKYUJDRIK-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | 5,8-dichloro-1,2,3,4-tetrahydroquinoline |
| InChIKey | RPFUXGKYUJDRIK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2NC1)Cl)Cl |
Computed by PubChem (NCBI)