Products 38969-63-0
CAS 38969-63-0 appears in our catalog under these names: Isoquinoline, 1,3-dichloro-5,6,7,8-tetrahydro-, 95%, 1,3-Dichloro-5,6,7,8-tetrahydroisoquinoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1,3-dichloro-5,6,7,8-tetrahydroisoquinoline (CAS 38969-63-0) is a chemical compound with the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. IUPAC name: 1,3-dichloro-5,6,7,8-tetrahydroisoquinoline. InChIKey: VOOZWGPLJMWMTA-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | 1,3-dichloro-5,6,7,8-tetrahydroisoquinoline |
| InChIKey | VOOZWGPLJMWMTA-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(N=C(C=C2C1)Cl)Cl |
Computed by PubChem (NCBI)