Products 2504203-37-4
CAS 2504203-37-4 is the registry number for (3-Chloro-5-ethynyl-phenyl)-methyl-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-chloro-5-ethynyl-N-methylaniline;hydrochloride (CAS 2504203-37-4) is a chemical compound with the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. IUPAC name: 3-chloro-5-ethynyl-N-methylaniline;hydrochloride. InChIKey: NIZJKWAZRMZTLB-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | 3-chloro-5-ethynyl-N-methylaniline;hydrochloride |
| InChIKey | NIZJKWAZRMZTLB-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=CC(=C1)C#C)Cl.Cl |
Computed by PubChem (NCBI)