CAS 1783400-57-6 appears in our catalog under these names: 6,7-Dichloro-1,2,3,4-tetrahydroquinoline, 95%, 6，7–Dichloro–1，2，3，4–tetrahydroquinoline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
6,7-dichloro-1,2,3,4-tetrahydroquinoline (CAS 1783400-57-6) is a chemical compound with the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. IUPAC name: 6,7-dichloro-1,2,3,4-tetrahydroquinoline. InChIKey: JOVVXQGVCSDDOH-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | 6,7-dichloro-1,2,3,4-tetrahydroquinoline |
| InChIKey | JOVVXQGVCSDDOH-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C=C2NC1)Cl)Cl |
Computed by PubChem (NCBI)