CAS 89315-56-0 appears in our catalog under these names: 5,7-Dichloro-1,2,3,4-tetrahydroisoquinoline, 95%, Lifitegrast Impurity 17, 5,7-Dichloro-1,2,3,4-tetrahydroisoquinoline, 5,7-Dichloro-1,2,3,4-tetrahydroisoquinoline 98%, 5,7-Dichloro-1,2,3,4-tetrahydroisoquinoline, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, on request, 2,5g, 10g, 25g.
5,7-dichloro-1,2,3,4-tetrahydroisoquinoline (CAS 89315-56-0) is a chemical compound with the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. IUPAC name: 5,7-dichloro-1,2,3,4-tetrahydroisoquinoline. InChIKey: QCSLOZFEMQTPJA-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | 5,7-dichloro-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | QCSLOZFEMQTPJA-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)