CAS 67120-42-7 is the registry number for 5,6-Dichloro-indan-1-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5,6-dichloro-2,3-dihydro-1H-inden-1-amine (CAS 67120-42-7) is a chemical compound with the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. IUPAC name: 5,6-dichloro-2,3-dihydro-1H-inden-1-amine. InChIKey: XWCCMCNCBDSVFJ-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | 5,6-dichloro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | XWCCMCNCBDSVFJ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C=C2C1N)Cl)Cl |
Computed by PubChem (NCBI)