CAS 2688735-27-3 is the registry number for 5,6-Dichloro-1-methylisoindoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dichloro-1-methyl-2,3-dihydro-1H-isoindole (CAS 2688735-27-3) is a chemical compound with the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. IUPAC name: 5,6-dichloro-1-methyl-2,3-dihydro-1H-isoindole. InChIKey: UNOXLAUAKJYCRT-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | 5,6-dichloro-1-methyl-2,3-dihydro-1H-isoindole |
| InChIKey | UNOXLAUAKJYCRT-UHFFFAOYSA-N |
| SMILES | CC1C2=CC(=C(C=C2CN1)Cl)Cl |
Computed by PubChem (NCBI)