CAS 1019385-55-7 is the registry number for 3-Oxo-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propanenitrile. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-oxo-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propanenitrile (CAS 1019385-55-7) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: 3-oxo-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propanenitrile. InChIKey: ZGCZNMNJWCFVBP-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 3-oxo-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propanenitrile |
| InChIKey | ZGCZNMNJWCFVBP-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=C(S2)C(=O)CC#N |
Computed by PubChem (NCBI)