Products 1019501-57-5

CAS 1019501-57-5 is the registry number for 4-[(4-Cyanophenyl)sulfanyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

4-(4-cyanophenyl)sulfanylbenzoic acid (CAS 1019501-57-5) is a chemical compound with the molecular formula C14H9NO2S and a molecular weight of 255.29 g/mol. IUPAC name: 4-(4-cyanophenyl)sulfanylbenzoic acid. InChIKey: HAVREHLLNXBABV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9NO2S
Molecular weight255.29 g/mol
IUPAC name4-(4-cyanophenyl)sulfanylbenzoic acid
InChIKeyHAVREHLLNXBABV-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C#N)SC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)