CAS 163725-12-0 is the registry number for 2-[(2-Cyanophenyl)thio]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 10g, 1g.
2-(2-cyanophenyl)sulfanylbenzoic acid (CAS 163725-12-0) is a chemical compound with the molecular formula C14H9NO2S and a molecular weight of 255.29 g/mol. IUPAC name: 2-(2-cyanophenyl)sulfanylbenzoic acid. InChIKey: FMGHXZOIAXNGOL-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 2-(2-cyanophenyl)sulfanylbenzoic acid |
| InChIKey | FMGHXZOIAXNGOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)SC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)